| Identification | ||
| Name: | m-Tolunitrile | |
| Synonyms: | 3-Methylbenzenecarbonitrile; CNT; Tolunitrile,98%; m-toluonitrile; 3-Methylbenzonitrile/m-Tolunitrile; 3-Methylbenzonitrile; META-TOLUNITRILE | |
| CAS: | 620-22-4 | |
| EINECS: | 210-631-5 | |
| Molecular Formula: | C8H7N | |
| Molecular Weight: | 117.15 | |
| InChI: | InChI=1/C8H7N/c1-7-3-2-4-8(5-7)6-9/h2-5H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 3276 | |
| Density: | 0.976 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.5246-1.5266 | |
| Water Solubility: | <0.1 g/100 mL at 25 ºC | |
| Solubility: | <0.1 g/100 mL at 25 oC | |
| Appearance: | Clear, Colorless Liquid or crystal | |
| Specification: | CLEAR COLOURLESS TO VERY SLIGHTLY YELLOW LIQUID Safety Statements:26-36/37/39-45-37-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37:Wear suitable gloves 36:Wear suitable protective clothing | |
| Packinggroup: | I; II | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
