| Identification | |
| Name: | m-Cresol |
| Synonyms: | 3-Hydroxytoluene; 3-Methylphenol; Meta-Cresol; m-methylphenol; Hydroxy-3-methylbenzene; 3-Cresol; 3-methyl-Phenol; 1-hydroxy-3-methylbenzene |
| CAS: | 108-39-4 |
| EINECS: | 203-577-9 |
| Molecular Formula: | C7H8O |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2076 |
| Density: | 1.034 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases, strong acids, aluminium, aluminium alloys. Air and light sensitive. Hygroscopic. |
| Refractive index: | 1.539-1.541 |
| Solubility: | 23 g/l SOLVENT |
| Appearance: | Clear to to slightly amber liquid |
| Packinggroup: | II |
| HS Code: | 29071200 |
| Color: | Colorless, yellowish, brownish-yellow, or pinkish liquid Colorless to yellow liquid [Note: A solid below 54 degrees F]. |
| Usage: | For making synthetic resins, in disinfectants and fumigants, as industrial solvent, in photographic developers, in explosives. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
