| Identification | |
| Name: | 4-Methylthio-M-Cresol |
| Synonyms: | 4-(Methylthio)-m-cresol; Methylthiomcresol; 95%; 3-Methyl-4-(methylthio)phenol |
| CAS: | 3120-74-9 |
| EINECS: | 221-496-7 |
| Molecular Formula: | C8H10OS |
| Molecular Weight: | 154.23 |
| InChI: | InChI=1/C8H10OS/c1-6-5-7(9)3-4-8(6)10-2/h3-5,9H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3335 |
| Density: | 1.15g/cm3 |
| Refractive index: | 1.591 |
| Specification: |
? Methylthiomethylphenol , with CAS number of 3120-74-9, can be called 3-Methyl-4-(methylthio)phenol ; 4-(Methylthio)-3-methylphenol ; 4-(Methylthio)-m-cresol ; 4-Hydroxy-2-methylthioanisole ; 4-Methylsulfanyl-3-methylphenol .?It is used for organic synthesis intermediates and pesticide intermediates. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
