| Identification | |
| Name: | 2,3-Bis(p-methoxyphenyl)-2-penteno nitrile |
| Synonyms: | 2,3-Bis(4-methoxyphenyl)-2-pentenenitrile;2,3-Bis(p-methoxyphenyl)-2-pentenenitrile;SC-3296 |
| CAS: | 53-64-5 |
| Molecular Formula: | C19H19NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C19H19NO2/c1-4-18(14-5-9-16(21-2)10-6-14)19(13-20)15-7-11-17(22-3)12-8-15/h5-12H,4H2,1-3H3/b19-18- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 152.9°C |
| Boiling Point: | 450.4°C at 760 mmHg |
| Density: | 1.085g/cm3 |
| Refractive index: | 1.565 |
| Specification: |
The extinguishing agent of 2,3-Bis(p-methoxyphenyl)-2-penteno nitrile (CAS NO.53-64-5) are dry powder , foam, sand, carbon dioxide, water mist. |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 152.9°C |
| Safety Data | |
 |
|
