| Identification | |
| Name: | p-Methoxyphenyl 2-pyridylketone |
| Synonyms: | 2-(4-METHOXYBENZOYL)PYRIDINE;(4-Methoxyphenyl)(2-pyridinyl) ketone;(4-Methoxyphenyl)2-pyridinylmethanone;4-Methoxyphenyl 2-pyridyl ketone;Brn 0152914;Ketone, p-methoxyphenyl 2-pyridyl;p-Methoxyphenyl 2-pyridylketone |
| CAS: | 6305-18-6 |
| Molecular Formula: | C13H11NO2 |
| Molecular Weight: | 213.23 |
| InChI: | InChI=1/C13H11NO2/c1-16-11-7-5-10(6-8-11)13(15)12-4-2-3-9-14-12/h2-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 175.8°C |
| Boiling Point: | 367°C at 760 mmHg |
| Density: | 1.154g/cm3 |
| Refractive index: | 1.572 |
| Specification: |
p-Methoxyphenyl 2-pyridylketone , its cas register number is 6305-18-6. It also can be called 5-21-12-00521 (Beilstein Handbook Reference) ; BRN 0152914 . When heated to decomposition it emits toxic vapors of NOx. |
| Flash Point: | 175.8°C |
| Safety Data | |
 |
|
