| Identification | |
| Name: | p-Ethoxyphenyl 2-pyridylketone |
| Synonyms: | 2-(4-ETHOXYBENZOYL)PYRIDINE |
| CAS: | 32941-23-4 |
| Molecular Formula: | C14H13NO2 |
| Molecular Weight: | 227.26 |
| InChI: | InChI=1/C14H13NO2/c1-2-17-12-8-6-11(7-9-12)14(16)13-5-3-4-10-15-13/h3-10H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 182.9°C |
| Boiling Point: | 378.8°C at 760 mmHg |
| Density: | 1.129g/cm3 |
| Refractive index: | 1.563 |
| Specification: |
p-Ethoxyphenyl 2-pyridylketone , its cas register number is 32941-23-4. It also can be called BRN 1530667 ; and Ketone, p-ethoxyphenyl 2-pyridyl . |
| Flash Point: | 182.9°C |
| Safety Data | |
 |
|
