| Identification | |
| Name: | Borane,chlorodiethyl- |
| Synonyms: | Borine,chlorodiethyl- (6CI); Chlorodiethylborane; Diethylboron chloride;Diethylchloroborane |
| CAS: | 5314-83-0 |
| Molecular Formula: | C4H10 B Cl |
| Molecular Weight: | 104.39 |
| InChI: | InChI=1/C4H10BCl/c1-3-5(6)4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 6.6°C |
| Boiling Point: | 87.2°Cat760mmHg |
| Density: | 0.816g/cm3 |
| Refractive index: | 1.369 |
| Specification: |
Chlorodiethylborane , its cas register number is 5314-83-0.When heated to decomposition it emits toxic fumes of Cl−. Chlorodiethylborane (CAS NO.5314-83-0) will ignite spontaneously in air. |
| Flash Point: | 6.6°C |
| Safety Data | |
 |
|
