| Identification | |
| Name: | Borane, triphenyl- |
| Synonyms: | Borine,triphenyl- (6CI);Triphenylborine;Triphenylboron; |
| CAS: | 960-71-4 |
| EINECS: | 213-504-2 |
| Molecular Formula: | C18H15B |
| Molecular Weight: | 242.12 |
| InChI: | InChI=1/C18H15B/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 17 C |
| Density: | 1.07 |
| Water Solubility: | Decomposes |
| Solubility: | Decomposes |
| Appearance: | white crystals |
| Specification: |
Triphenylborane, often abbreviated to BPh3 where Ph is the phenyl group C6H5-, is a chemical compound with the formula B(C6H5)3. It is a white crystalline solid and is both air and moisture sensitive, slowly forming benzene and triphenylboroxine. It is soluble in aromatic solvents. |
| Packinggroup: | III |
| Flash Point: | 17 C |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
