| Identification | |
| Name: | 2-Propen-1-ol,3-phenyl-, 1-benzoate |
| Synonyms: | 2-Propen-1-ol,3-phenyl-, benzoate (9CI); Cinnamyl alcohol, benzoate (6CI,7CI,8CI);3-Phenyl-2-propenyl benzoate; Cinnamyl benzoate; NSC 245146 |
| CAS: | 5320-75-2 |
| EINECS: | 226-180-2 |
| Molecular Formula: | C16H14 O2 |
| Molecular Weight: | 238.30 |
| InChI: | InChI=1/C16H14O2/c17-16(15-11-5-2-6-12-15)18-13-7-10-14-8-3-1-4-9-14/h1-12H,13H2/b10-7+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 176.1°C |
| Boiling Point: | 385°Cat760mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.607 |
| Specification: |
Cinnamyl benzoate , its cas register number is 5320-75-2. It also can be called 2-Propen-1-ol,3-phenyl-,1-benzoate ; 2-Propen-1-ol,3-phenyl-,benzoate ; Cinnamyl alcohol,benzoate (8CI) and Cinnamyl benzoate .When heated to decomposition it emits acrid smoke and irritating fumes. Cinnamyl benzoate (CAS NO.5320-75-2) should be kept away from skin and eye. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 176.1°C |
| Safety Data | |
 |
|
