| Identification | |
| Name: | L-Arabinose |
| Synonyms: | Arabinose,L- (8CI);(+)-Arabinose;L-(+)-Arabinose;NSC 1941; |
| CAS: | 5328-37-0 |
| EINECS: | 226-214-6 |
| Molecular Formula: | C5H10O5 |
| Molecular Weight: | 150.1299 |
| InChI: | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 155 oC |
| Density: | 1.508g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Alpha: | 104 o (C=6, IN WATER 23 oC) |
| Appearance: | white crystalline powder |
| Specification: |
L-Arabinose , its cas register number is 5328-37-0. It also can be called L(+)Arabinose; Amidosulfonic acid; 4-Dimethylaminobenzalrhodanine ; and L-Arabinopyranose . |
| Safety Data | |
 |
|
