| Identification | |
| Name: | Benzenemethanamine,N-nitroso-N-(phenylmethyl)- |
| Synonyms: | Dibenzylamine,N-nitroso- (6CI,7CI,8CI); Dibenzylnitrosamine; N,N-Dibenzylnitrosamine;N-Nitrosodibenzylamine; NSC 338; Nitrosodibenzylamine |
| CAS: | 5336-53-8 |
| Molecular Formula: | C14H14 N2 O |
| Molecular Weight: | 226.30 |
| InChI: | InChI=1/C14H14N2O/c17-15-16(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 208.4°C |
| Boiling Point: | 420.9°Cat760mmHg |
| Density: | 1.05g/cm3 |
| Refractive index: | 1.567 |
| Specification: | Yellow Low Melting Solid usageEng:N-Nitrosodibenzylamine (NDBzA) is mutagenic to Salmonella typhimurium and induces DNA strand breaks in isolated rat hepatocytes. |
| Flash Point: | 208.4°C |
| Usage: | N-Nitrosodibenzylamine (NDBzA) is mutagenic to Salmonella typhimurium and induces DNA strand breaks in isolated rat hepatocytes. |
| Safety Data | |
 |
|
