| Identification | |
| Name: | D-Homocysteine,S-ethyl- |
| Synonyms: | Butyricacid, 2-amino-4-(ethylthio)-, D- (8CI);D-Ethionine;NSC 97927; |
| CAS: | 535-32-0 |
| EINECS: | 208-612-1 |
| Molecular Formula: | C6H13NO2S |
| Molecular Weight: | 163.24 |
| InChI: | InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 141.5°C |
| Boiling Point: | 310.4°Cat760mmHg |
| Density: | 1.164g/cm3 |
| Refractive index: | 1.523 |
| Appearance: | white powder. |
| Specification: | White Crystalline Solid usageEng:An Amino Acid derivative. Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 141.5°C |
| Color: | Crystals |
| Usage: | An Amino Acid derivative. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
