| Identification | |
| Name: | Benzene,1-methyl-3-(1-methylethyl)- |
| Synonyms: | m-Cymene(8CI); 1-Isopropyl-3-methylbenzene; 1-Methyl-3-(1-methylethyl)benzene;1-Methyl-3-isopropylbenzene; 3-Isopropyltoluene; NSC 73975; m-Cymol;m-Isopropyltoluene; m-Methylisopropylbenzene; b-Cymene |
| CAS: | 535-77-3 |
| EINECS: | 208-617-9 |
| Molecular Formula: | C10H14 |
| Molecular Weight: | 134.24 |
| InChI: | InChI=1/C10H14/c1-8(2)10-6-4-5-9(3)7-10/h4-8H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2046 3/PG 3 |
| Melting Point: | −64 °C(lit.) |
| Flash Point: | 47 °C |
| Boiling Point: | 175 °C(lit.) |
| Density: | 0.861 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.492(lit.) |
| Solubility: | Miscible with ethanol, ether, and acetone In water, 42.5 mg/l @ 25 deg C |
| Specification: |
To protect yourself, you can put on eyeshields, faceshields, full-face respirator (US), gloves, multi-purpose combination respirator cartridge (US), type ABEK (EN14387) respirator filter. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 47 °C |
| Safety Data | |
 |
|
