| Identification |
| Name: | Phosphoramidodithioicacid, dimethyl-, O-ethyl ester, S-ester with dihydro-3-mercapto-2(3H)-furanone(8CI) |
| Synonyms: | Butyricacid, 4-hydroxy-2-mercapto-, g-lactone, S-ester with O-ethyl dimethylphosphoramidodithioate (7CI);2(3H)-Furanone, dihydro-3-mercapto-, S-ester with O-ethyldimethylphosphoramidothioate |
| CAS: | 5357-43-7 |
| Molecular Formula: | C8H16 N O3 P S2 |
| Molecular Weight: | 255.3117 |
| InChI: | InChI=1/C16H17NO2/c1-3-19-15-11-7-6-10-14(15)17-16(18)13-9-5-4-8-12(13)2/h4-11H,3H2,1-2H3,(H,17,18) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 153.7°C |
| Boiling Point: | 330.5°C at 760 mmHg |
| Density: | 1.134g/cm3 |
| Refractive index: | 1.599 |
| Flash Point: | 153.7°C |
| Safety Data |
| |
 |
