Identification |
Name: | Phosphorotrithioicacid, S,S-dimethyl ester, S-ester with 2-mercapto-N-methylacetamide (7CI,8CI) |
Synonyms: | Acetamide,2-mercapto-N-methyl-, S-ester with S,S-dimethyl phosphorotrithioate |
CAS: | 5756-19-4 |
Molecular Formula: | C5H12 N O2 P S3 |
Molecular Weight: | 346.3346 |
InChI: | InChI=1/C17H18N2O6/c1-4-25-16-7-5-11(9-14(16)19(21)22)17(20)18-13-10-12(23-2)6-8-15(13)24-3/h5-10H,4H2,1-3H3,(H,18,20) |
Molecular Structure: |
 |
Properties |
Flash Point: | 233.2°C |
Boiling Point: | 462°C at 760 mmHg |
Density: | 1.289g/cm3 |
Refractive index: | 1.601 |
Flash Point: | 233.2°C |
Safety Data |
|
 |