Identification |
Name: | Phosphorotrithioicacid, O-propyl ester, S,S-diester with 2-mercaptoacetamide (7CI,8CI) |
Synonyms: | Acetamide,2-mercapto-, S,S-diester with O-propyl phosphorotrithioate |
CAS: | 7233-51-4 |
Molecular Formula: | C7H15 N2 O3 P S3 |
Molecular Weight: | 513.4139 |
InChI: | InChI=1/C30H22Cl2N2O2/c31-29(35)33(19-21-11-3-1-4-12-21)27-23-15-7-9-17-25(23)28(26-18-10-8-16-24(26)27)34(30(32)36)20-22-13-5-2-6-14-22/h1-18H,19-20H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 413.8°C |
Boiling Point: | 760.5°C at 760 mmHg |
Density: | 1.379g/cm3 |
Refractive index: | 1.735 |
Flash Point: | 413.8°C |
Safety Data |
|
|