| Identification | |
| Name: | Pentanoic acid,5-hydroxy-2-propyl- |
| Synonyms: | 2-Propyl-5-hydroxypentanoic acid;2-n-Propyl-5-hydroxypentanoic acid;2-n-Propyl-5-hydroxyvaleric acid;5-Hydroxy-2-propylpentanoic acid;5-Hydroxy-2-propylvaleric acid;5-Hydroxyvalproic acid; |
| CAS: | 53660-23-4 |
| Molecular Formula: | C8H16O3 |
| Molecular Weight: | 160.21 |
| InChI: | InChI=1/C8H16O3/c1-2-4-7(8(10)11)5-3-6-9/h7,9H,2-6H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 144.1 ºC |
| Boiling Point: | 291.2 ºC |
| Density: | 1.046 g/cm3 |
| Stability: | Hygroscopic, |
| Refractive index: | 1.463 |
| Specification: | Pale Yellow Thick Syrup usageEng:A metabolite of Valproic Acid. This compounds contains an undetermied amount of water and the analogous lactone |
| Flash Point: | 144.1 ºC |
| Usage: | A metabolite of Valproic Acid. This compounds contains an undetermied amount of water and the analogous lactone |
| Safety Data | |
 |
|
