Identification |
Name: | Pentanoic acid,3-hydroxy-2-propyl- |
Synonyms: | 2-Propyl-3-hydroxypentanoicacid; 2-Propyl-3-hydroxyvaleric acid; 2-n-Propyl-3-hydroxypentanoic acid;3-Hydroxy-2-propylpentanoic acid; 3-Hydroxyvalproic acid |
CAS: | 58888-84-9 |
Molecular Formula: | C8H16 O3 |
Molecular Weight: | 160.21 |
InChI: | InChI=1/C8H16O3/c1-3-5-6(8(10)11)7(9)4-2/h6-7,9H,3-5H2,1-2H3,(H,10,11) |
Molecular Structure: |
|
Properties |
Flash Point: | 137.8°C |
Boiling Point: | 280.7°C at 760 mmHg |
Density: | 1.043g/cm3 |
Refractive index: | 1.461 |
Specification: | Thick Yellow oil usageEng:A metabolite of Valproic Acid |
Flash Point: | 137.8°C |
Usage: | A metabolite of Valproic Acid |
Safety Data |
|
|