| Identification |
| Name: | 2-Propenoic acid,3-(4-hydroxy-3-methoxyphenyl)-, (2E)- |
| Synonyms: | 2-Propenoicacid, 3-(4-hydroxy-3-methoxyphenyl)-, (E)-;Cinnamic acid,4-hydroxy-3-methoxy-, (E)- (8CI);(2E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoicacid;(E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid;(E)-4-Hydroxy-3-methoxycinnamic acid;(E)-Ferulic acid;trans-4-Hydroxy-3-methoxycinnamic acid; |
| CAS: | 537-98-4 |
| EINECS: | 208-679-7 |
| Molecular Formula: | C10H10O4 |
| Molecular Weight: | 194.18 |
| InChI: | InChI=1/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.316 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Skin, eye and respiratory irritant. Toxicology not fully investigated. Toxicity data (The |
| Solubility: | |
| Appearance: | slightly yellow powder |
| Color: | slightly yellow |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
