| Identification | |
| Name: | Benzeneethanamine, N,a-dimethyl-N-(phenylmethyl)-,hydrochloride (1:1), (aS)- |
| Synonyms: | Benzeneethanamine,N,a-dimethyl-N-(phenylmethyl)-,hydrochloride, (S)-; Benzeneethanamine, N,a-dimethyl-N-(phenylmethyl)-, hydrochloride, (aS)- (9CI); Phenethylamine,N-benzyl-N,a-dimethyl-, hydrochloride, (+)-(8CI); (+)-Benzphetamine hydrochloride; Benzphetamine hydrochloride; Didrex;Inapetyl; NSC 10937; U-0441; d-Benzphetamine hydrochloride |
| CAS: | 5411-22-3 |
| EINECS: | 226-489-2 |
| Molecular Formula: | C17H21 N . Cl H |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C17H21N.ClH/c1-15(13-16-9-5-3-6-10-16)18(2)14-17-11-7-4-8-12-17;/h3-12,15H,13-14H2,1-2H3;1H/t15-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Flash Point: | 141.5°C |
| Boiling Point: | 334.3°Cat760mmHg |
| Density: | g/cm3 |
| Specification: | usageEng:The S-enantiomer of Benzphetamine (B209880). Controlled substance (stimulant). Anorexic. Safety Statements:22-36/37/39-45-36/37-16 22:Do not breathe dust 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves 16:Keep away from sources of ignition - No smoking |
| Flash Point: | 141.5°C |
| Storage Temperature: | 2-8°C |
| Usage: | The S-enantiomer of Benzphetamine (B209880). Controlled substance (stimulant). Anorexic. |
| Safety Data | |
 |
|
