Identification |
Name: | Ethanol, 2-chloro-,1-acetate |
Synonyms: | Ethanol,2-chloro-, acetate (6CI,7CI,8CI,9CI); 1-Acetoxy-2-chloroethane;2-Acetoxy-1-chloroethane; 2-Acetoxyethyl chloride; 2-Chloroethanol acetate;2-Chloroethyl acetate; Acetic acid 2-chloroethyl ester; NSC 77374; b-Chloroethyl acetate |
CAS: | 542-58-5 |
EINECS: | 208-820-2 |
Molecular Formula: | C4H7 Cl O2 |
Molecular Weight: | 122.56 |
InChI: | InChI=1/C4H7ClO2/c1-4(6)7-3-2-5/h2-3H2,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 2929 |
Flash Point: | 54°C |
Boiling Point: | 145°C |
Density: | 1,16 g/cm3 |
Refractive index: | 1.411 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 54°C |
Safety Data |
|
 |