| Identification | |
| Name: | adipic acid, compound with 1,4-bis(3-aminopropyl)piperazine (1:1) |
| Synonyms: | Hexanedioic acid, compd. with 1,4-piperazinedipropanamine (1:1);1,4-Bis(3-aminopropyl)piperazine adipate (1:1);NSC 13218;Adipic acid, compd. with 1,4-bis(3-aminopropyl)piperazine (1:1) (8CI);Adipic acid, compound with 1,4-bis(3-aminopropyl)piperazine (1:1);hexanedioic acid - 3,3'-piperazine-1,4-diyldipropan-1-amine (1:1) |
| CAS: | 5423-61-0 |
| EINECS: | 226-555-0 |
| Molecular Formula: | C16H34N4O4 |
| Molecular Weight: | 346.4656 |
| InChI: | InChI=1/C10H24N4.C6H10O4/c11-3-1-5-13-7-9-14(10-8-13)6-2-4-12;7-5(8)3-1-2-4-6(9)10/h1-12H2;1-4H2,(H,7,8)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.8°C |
| Boiling Point: | 334.5°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.8°C |
| Safety Data | |
 |
|
