| Identification | |
| Name: | adipic acid, compound with 1-methyldodecylamine (1:1) |
| Synonyms: | Decidin;Adipic acid, compound with 1-methyldodecylamine (1:1);Hexanedioic acid, compd. with 2-tridecanamine (1:1);hexanedioic acid - tridecan-2-amine (1:1) |
| CAS: | 31698-46-1 |
| EINECS: | 250-767-2 |
| Molecular Formula: | C19H39NO4 |
| Molecular Weight: | 345.5173 |
| InChI: | InChI=1/C13H29N.C6H10O4/c1-3-4-5-6-7-8-9-10-11-12-13(2)14;7-5(8)3-1-2-4-6(9)10/h13H,3-12,14H2,1-2H3;1-4H2,(H,7,8)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 113.6°C |
| Boiling Point: | 267.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 113.6°C |
| Safety Data | |
 |
|
