| Identification |
| Name: | stearic acid, compound with 1-dodecylpiperidine (1:1) |
| Synonyms: | Octadecanoic acid, compd. with 1-dodecylpiperidine (1:1);Dodecylpiperidine octadecanoate;N-Dodecylpiperidinium stearate;Stearic acid, compound with 1-dodecylpiperidine (1:1);octadecanoic acid - 1-dodecylpiperidine (1:1) |
| CAS: | 68141-04-8 |
| EINECS: | 268-826-6 |
| Molecular Formula: | C35H71NO2 |
| Molecular Weight: | 537.9437 |
| InChI: | InChI=1/C18H36O2.C17H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-12-15-18-16-13-11-14-17-18/h2-17H2,1H3,(H,19,20);2-17H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.4°C |
| Safety Data |
| |
 |
