| Identification |
| Name: | stearic acid, compound with 1,3,5-triazine-2,4,6-triamine (1:1) |
| Synonyms: | Octadecanoic acid, compd. with 1,3,5-triazine-2,4,6-triamine (1:1);Stearic acid, compd. with melamine (1:1);Stearic acid, compound with 1,3,5-triazine-2,4,6-triamine (1:1);octadecanoic acid - 1,3,5-triazine-2,4,6-triamine (1:1) |
| CAS: | 72076-42-7 |
| EINECS: | 276-321-7 |
| Molecular Formula: | C21H42N6O2 |
| Molecular Weight: | 410.5972 |
| InChI: | InChI=1/C18H36O2.C3H6N6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;4-1-7-2(5)9-3(6)8-1/h2-17H2,1H3,(H,19,20);(H6,4,5,6,7,8,9) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.4°C |
| Safety Data |
| |
 |
