Identification |
Name: | Stearic acid, compound with triethylamine (1:1) |
Synonyms: | Stearic acid, compound with triethylamine (1:1);octadecanoic acid - N,N-diethylethanamine (1:1) |
CAS: | 16207-83-3 |
EINECS: | 240-336-7 |
Molecular Formula: | C24H51NO2 |
Molecular Weight: | 385.6672 |
InChI: | InChI=1/C18H36O2.C6H15N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-7(5-2)6-3/h2-17H2,1H3,(H,19,20);4-6H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 162.4°C |
Boiling Point: | 359.4°C at 760 mmHg |
Flash Point: | 162.4°C |
Safety Data |
|
 |