Identification |
Name: | stearic acid, compound with N,N-dimethyldodecylamine (1:1) |
Synonyms: | Octadecanoic acid, compd. with N,N-dimethyl-1-dodecanamine (1:1);Lauryldimethylamine stearate;Stearic acid lauryldimethylamine salt;Stearic acid, compound with N,N-dimethyldodecylamine (1:1);octadecanoic acid - N,N-dimethyldodecan-1-amine (1:1) |
CAS: | 70715-12-7 |
EINECS: | 274-815-7 |
Molecular Formula: | C32H67NO2 |
Molecular Weight: | 497.8799 |
InChI: | InChI=1/C18H36O2.C14H31N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h2-17H2,1H3,(H,19,20);4-14H2,1-3H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 162.4°C |
Boiling Point: | 359.4°C at 760 mmHg |
Flash Point: | 162.4°C |
Safety Data |
|
|