| Identification | |
| Name: | N,N-dimethyldodecylamine |
| Synonyms: | Dodecyl-tetradecyl dimethyl amine; Dodecyl dimethyl amine |
| CAS: | 112-18-5 |
| EINECS: | 203-943-8 |
| Molecular Formula: | C14H31N |
| Molecular Weight: | 213.4 |
| InChI: | InChI=1/C14H31N/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h4-14H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Density: | 0.787 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4365-1.4385 |
| Water Solubility: | Negligible |
| Solubility: | AUTOIGNITION |
| Appearance: | clear liquid |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Corrosives area. |
| Color: | Liquid |
| Usage: | Barlene(R) tertiary amines are used as chemical intermediates for the manufacture of quaternary ammonium compounds, amine oxide and betaine surfactants |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
