| Identification |
| Name: | 3-Benzoylpyridine |
| Synonyms: | Phenyl 3-pyridyl ketone; 3-Benzoylpyridine, (Phenyl 3-pyridyl ketone); phenyl(pyridin-3-yl)methanone |
| CAS: | 5424-19-1 |
| EINECS: | 226-561-3 |
| Molecular Formula: | C12H9NO |
| Molecular Weight: | 183.21 |
| InChI: | InChI=1/C12H9NO/c14-12(10-5-2-1-3-6-10)11-7-4-8-13-9-11/h1-9H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.139g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.606 (25 C) |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | White to pale yellowish crystals |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
