| Identification | |
| Name: | 1H-Pyrrole-3-propanoicacid, 5-(ethoxycarbonyl)-2,4-dimethyl-, ethyl ester |
| Synonyms: | Pyrrole-3-propionicacid, 5-carboxy-2,4-dimethyl-, diethyl ester (6CI,7CI); 2-Ethoxycarbonyl-4-(2-ethoxycarbonylethyl)-3,5-dimethylpyrrole;NSC 157290 |
| CAS: | 54278-10-3 |
| Molecular Formula: | C14H21 N O4 |
| Molecular Weight: | 267.32 |
| InChI: | InChI=1/C14H21NO4/c1-5-18-12(16)8-7-11-9(3)13(15-10(11)4)14(17)19-6-2/h15H,5-8H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.111 g/cm3 |
| Refractive index: | 1.51 |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
