| Identification | |
| Name: | 2-Heptanol |
| Synonyms: | Isoheptanol; |
| CAS: | 543-49-7 |
| EINECS: | 208-844-3 |
| Molecular Formula: | C7H16O |
| Molecular Weight: | 116.2 |
| InChI: | InChI=1/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 |
| Density: | 0.8175 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, strong acids. |
| Refractive index: | 1.42-1.422 |
| Water Solubility: | 0.35 g/100 mL |
| Solubility: | 0.35 g/100 mL in water |
| Appearance: | Colorless liquid |
| Specification: |
2-Heptanol , its cas register number is 543-49-7. It also can be called 1-Methylhexanol ; 2-Heptyl alcohol ; 2-Hydroxyheptane ; 3-01-00-01685 (Beilstein Handbook Reference) ; Amyl methyl carbinol ; Heptanol-2 ; Heptyl alcohol, sec- ; Methyl amyl carbinol ; s-Heptyl alcohol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29051900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | 2-Heptanol is used as a solvent for synthetic resins; and as a frothing agent in ore flotation. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
