| Identification | |
| Name: | 2-Heptanol, (2S)- |
| Synonyms: | 2-Heptanol,(+)- (8CI); 2-Heptanol, (S)-; (+)-2-Heptanol; (S)-(+)-2-Heptanol;(S)-2-Heptanol; d-2-Heptanol; d-2-Hydroxyheptane; d-Amylmethylcarbinol |
| CAS: | 6033-23-4 |
| Molecular Formula: | C7H16O |
| Molecular Weight: | 116.2 |
| InChI: | InChI=1/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN1987 |
| Density: | 0.815 |
| Refractive index: | 1.421 |
| Alpha: | 9.5 º (NEAT) |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
(S)-(+)-2-Heptanol (6033-23-4) is a chiral compound with appearance of colorless to light yellow liquid. (S)-(+)-2-Heptanol (6033-23-4) is also known as (S)-(+)-2-Hydroxyheptane ; (S)-(+)-2-Heptanol ; (S)-2-Heptanol ; (S)-Heptan-2-ol ; l-(-)-2-Heptanol ; (S)-(+)-Heptanol ; (S)-(+)-2-Heptanol 98% ; (2S)-2-Heptanol . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
