| Identification |
| Name: | 4,4-Dimethoxy-2-butanone |
| Synonyms: | Acetylacetaldehyde dimethyl acetal |
| CAS: | 5436-21-5 |
| EINECS: | 226-605-1 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C6H12O3/c1-5(7)4-6(8-2)9-3/h6H,4H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1989 |
| Density: | 0.993 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.414-1.416 |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | Colorless to yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29145000 |
| Storage Temperature: | Flammables area |
| Safety Data |
| |
 |
