| Identification | ||
| Name: | Myristic acid | |
| Synonyms: | Myristic acid (8CI);1-Tridecanecarboxylic acid;Edenor C 14;Emery 655;Hystrene9014;Kortacid 1499;LunacMY 98;NAA 104;NAA 142;NSC 5028;Neo-Fat 14;Philacid1400;Prifac 2942;Prifrac2942;Univol U 316S;n-Tetradecan-1-oic acid;n-Tetradecanoic acid;n-Tetradecoicacid;Tetradecanoicn acid; | |
| CAS: | 544-63-8 | |
| EINECS: | 208-875-2 | |
| Molecular Formula: | C14H28O2 | |
| Molecular Weight: | 228.37 | |
| InChI: | InChI=1/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16) | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 0.898 g/cm3 | |
| Stability: | Stable. Incompatible with strong oxidizing agents, bases. | |
| Refractive index: | 1.4305 (20 C) | |
| Water Solubility: | ||
| Solubility: | <0.1 g/100 mL at 18 oC in water | |
| Appearance: | white solid. | |
| Specification: | white solid Safety Statements:24/25 24/25:Avoid contact with skin and eyes | |
| HS Code: | 29159080 | |
| Color: | Oily, white, crystalline solid Crystals from methanol Leaflets from ethyl ether | |
| Usage: | In soaps & perfumes, in synthesis of esters for flavorings & perfumes, & a component of food-grade additives. | |
| Safety Data | ||
 |
||
