Identification |
Name: | myristic acid, compound with 2-aminoethanol (1:1) |
Synonyms: | Tetradecanoic acid, compd. with 2-aminoethanol (1:1);Monoethanolamine myristate;Myristic acid, ethanolamine salt;Myristic acid, compound with 2-aminoethanol (1:1);tetradecanoic acid - 2-aminoethanol (1:1) |
CAS: | 31756-97-5 |
EINECS: | 250-791-3 |
Molecular Formula: | C16H35NO3 |
Molecular Weight: | 289.454 |
InChI: | InChI=1/C14H28O2.C2H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;3-1-2-4/h2-13H2,1H3,(H,15,16);4H,1-3H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 144.8°C |
Boiling Point: | 319.6°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 144.8°C |
Safety Data |
|
 |