| Identification |
| Name: | nicotinic acid, compound with 2-aminoethanol (1:1) |
| Synonyms: | Neopeviton;Nicotinic acid monoethanolamine salt;2-Aminoethanol compd. with nicotinic acid;Ethanolamine nicotinate;Monoethanolamine nicotinate;Neo-periton;Nicamin;Nicatol;Nikatol;3-Pyridinecarboxylic acid, compd. with 2-aminoethanol (1:1) (9CI);Nicotinic acid, compd. with 2-aminoethanol (1:1);Nicotinic acid, compound with 2-aminoethanol (1:1);pyridine-3-carboxylic acid - 2-aminoethanol (1:1) |
| CAS: | 3570-15-8 |
| EINECS: | 222-670-5 |
| Molecular Formula: | C8H12N2O3 |
| Molecular Weight: | 184.1925 |
| InChI: | InChI=1/C6H5NO2.C2H7NO/c8-6(9)5-2-1-3-7-4-5;3-1-2-4/h1-4H,(H,8,9);4H,1-3H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 130.7°C |
| Boiling Point: | 292.5°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 130.7°C |
| Safety Data |
| |
 |
