Identification |
Name: | cinnamic acid, compound with 2-aminoethanol (1:1) |
Synonyms: | Cinnamic acid, compound with 2-aminoethanol (1:1);2-aminoethanol; (E)-3-phenylprop-2-enoic acid |
CAS: | 94237-05-5 |
EINECS: | 304-103-4 |
Molecular Formula: | C11H15NO3 |
Molecular Weight: | 209.2417 |
InChI: | InChI=1/C9H8O2.C2H7NO/c10-9(11)7-6-8-4-2-1-3-5-8;3-1-2-4/h1-7H,(H,10,11);4H,1-3H2/b7-6+; |
Molecular Structure: |
 |
Properties |
Flash Point: | 215.7°C |
Boiling Point: | 433.1°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 215.7°C |
Safety Data |
|
 |