| Identification | |
| Name: | PVM/MACOPOLYMER,ETHYLESTER |
| Synonyms: | Ethyl ester of pvm/MA copolymer;2-Butenedioic acid (Z)-, monoethyl ester, polymer with methoxyethene;2-Butenedioic acid (2Z)-, monoethyl ester, polymer with methoxyethene;2-Butenedioic acid (Z)-, monoethyl ester, polymer with methoxyethane;25087-06-3;50935-57-4;Gantrez ES 225;AC1O5UCS;LS-47020;(Z)-4-ethoxy-4-oxobut-2-enoic acid; methoxyethene;3-Butenedioic acid (Z)-, polymer with methoxyethene, ethyl ester;2-Butenedioic acid (2Z)-, 1-ethyl ester, polymer with methoxyethene;54578-90-4 |
| CAS: | 54578-90-4 |
| Molecular Formula: | C9H14O5 |
| Molecular Weight: | 202.20446 |
| InChI: | InChI=1S/C6H8O4.C3H6O/c1-2-10-6(9)4-3-5(7)8;1-3-4-2/h3-4H,2H2,1H3,(H,7,8);3H,1H2,2H3/b4-3-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 109.6°C |
| Boiling Point: | 261.6°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 109.6°C |
| Safety Data | |
 |
|
