Identification |
Name: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethenol andethenyl acetate |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethenol and ethenyl acetate |
CAS: | 54626-91-4 |
Molecular Formula: | C11H18O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C5H8O2.C4H6O2.C2H4O/c1-4(2)5(6)7-3;1-3-6-4(2)5;1-2-3/h1H2,2-3H3;3H,1H2,2H3;2-3H,1H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 10°C |
Boiling Point: | 100.3°C at 760 mmHg |
Flash Point: | 10°C |
Safety Data |
|
 |