| Identification | |
| Name: | Estra-1,3,5(10)-triene-3,16,17-triol,(16b,17b)- |
| Synonyms: | Estra-1,3,5(10)-triene-3,16b,17-triol (7CI);Estra-1,3,5(10)-triene-3,16b,17b-triol (8CI); 16-Epiestratriol;16-Epiestriol; 16-epi-Estriol; 16b,17b-Estriol; 16b-Hydroxyestradiol; Actriol;Epiestriol; NSC 26646 |
| CAS: | 547-81-9 |
| EINECS: | 208-937-9 |
| Molecular Formula: | C18H24O3 |
| Molecular Weight: | 288.38 |
| InChI: | InChI=1/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,17+,18+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 289-2910C |
| Flash Point: | 220.8°C |
| Boiling Point: | 469°C at 760 mmHg |
| Density: | 1.255g/cm3 |
| Refractive index: | 1.624 |
| Specification: | Crystalline Solid usageEng:A metabolite of Estradiol |
| Flash Point: | 220.8°C |
| Usage: | A metabolite of Estradiol |
| Safety Data | |
 |
|
