| Identification | |
| Name: | 4-(4-Hydroxyphenyl)-2-butanone |
| Synonyms: | 2-Butanone,4-(p-hydroxyphenyl)- (6CI,7CI,8CI);(4-Hydroxybenzyl)acetone;(p-Hydroxybenzyl)acetone;1-(4-Hydroxyphenyl)-3-butanone;1-(p-Hydroxyphenyl)-3-butanone;4-(3-Oxobutyl)phenol;4-(p-Hydroxyphenyl)-2-butanone;Frambinone;NSC 26515;Oxyphenylon;Raspberryketone;Rheosmin; |
| CAS: | 5471-51-2 |
| EINECS: | 226-806-4 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-7,12H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.088 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.535 |
| Water Solubility: | Insoluble in water; Soluble in ethanol and diethyl ether |
| Solubility: | insoluble in water, soluble in ethanol, ether and volatile oil |
| Appearance: | white powder |
| Specification: |
?Raspberry ketone (CAS NO.5471-51-2) is also named as 1-(4-Hydroxyphenyl)-3-butanone ; 1-(p-Hydroxyphenyl)-3-butanone ; 2-Butanone, 4-(4-hydroxyphenyl)- ; 2-Butanone, 4-(p-hydroxyphenyl)- ; 4-(3-Oxobutyl)phenol ; 4-(4-Hydroxyphenyl)-2-butanone ; 4-(p-Hydroxyphenyl)-2-butanone ; 4-(p-Hydroxyphenyl)-2-butanone (natural) ; 4-08-00-00506 (Beilstein Handbook Reference) ; AI3-31812 ; BRN 0776080 ; FEMA No. 2588 ;?Frambinone ; Hydroxyphenylbutanone, p- ; NSC 26515 ; Oxyphenalon ; Rasketone ; Rheosmin ; UNII-7QY1MH15BG ; p-Hydroxybenzyl acetone . It is insoluble in water, soluble in ethanol, ether and volatile oil. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
