| Identification | |
| Name: | 3-Pyridinepropanoicacid, b-oxo-, methyl ester |
| Synonyms: | 3-Pyridinepropionicacid, b-oxo-, methyl ester (6CI);3-Oxo-3-(pyridin-3-yl)propanoic acid methyl ester; 3-Oxo-3-pyridin-3-ylpropionicacid methyl ester; Methyl 3-oxo-3-(3-pyridinyl)propanoate; Methylnicotinoylacetate |
| CAS: | 54950-20-8 |
| Molecular Formula: | C9H9 N O3 |
| Molecular Weight: | 179.1727 |
| InChI: | InChI=1/C9H9NO3/c1-13-9(12)5-8(11)7-3-2-4-10-6-7/h2-4,6H,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 34-42 ºC |
| Density: | 1.189 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.514 |
| Water Solubility: | NEGLEGIBLE |
| Solubility: | Water solubility, neglegible |
| Appearance: | white to pink-brownish crystalline powder |
| Specification: |
Methyl nicotinoylacetate , its cas register number is 54950-20-8. It also can be called Methyl (3-pyridinecarbonyl)acetate ; 3-Pyridinepropanoic acid, beta-oxo-, methyl ester .It is a white to pink-brownish crystalline powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
