| Identification | |
| Name: | 3-Pyridinepropanoicacid, 2,6-dichloro-5-fluoro-b-oxo-, ethyl ester |
| Synonyms: | Ethyl2,6-dichloro-5-fluoro-b-oxo-3-pyridinepropanoate;Ethyl 2,6-dichloro-5-fluoronicotinoylacetate;Ethyl 3-(2,6-dichloro-5-fluoro-3-pyridyl)-3-oxopropanoate;Ethyl3-(2,6-dichloro-5-fluoropyridin-3-yl)-3-oxopropanoate;(ethyl 2-6-dichloro-5-fluoro-pyridine-3-acetoacetate; |
| CAS: | 96568-04-6 |
| Molecular Formula: | C10H8Cl2FNO3 |
| Molecular Weight: | 280.08 |
| InChI: | InChI=1/C10H8Cl2FNO3/c1-2-17-8(16)4-7(15)5-3-6(13)10(12)14-9(5)11/h3H,2,4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.434 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.524 |
| Solubility: | Insoluble |
| Appearance: | Off-white powder |
| Specification: |
??3-Pyridinepropanoicacid, 2,6-dichloro-5-fluoro-b-oxo-, ethyl ester ,?its cas register number is 96568-04-6. It also can be called?Ethyl 2,6-dichloro-5-fluoro-pyridine-3-acetoacetate ;?Ethyl 2,6-dichloro-5-fluornicotinoylacetate ;?Ethyl 3-(2,6-dichloro-5-fluoropyridin-3-yl)-3-oxopropanoate ;?Ethyl 3-[2,6-dichloro-5-fluoro-(3-pyridiyl)]-3-oxopropanoate .?3-Pyridinepropanoicacid, 2,6-dichloro-5-fluoro-b-oxo-, ethyl ester (CAS NO.96568-04-6) is?irritating to eyes, respiratory system and skin. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
