| Identification | |
| Name: | Tyrosine, 3-hydroxy-a-methyl- |
| CAS: | 55-40-3 |
| EINECS: | 200-232-4 |
| Molecular Formula: | C10H13 N O4 |
| Molecular Weight: | 211.21 |
| InChI: | InChI=1/C10H13NO4/c1-5(9(11)10(14)15)6-2-3-7(12)8(13)4-6/h2-5,9,12-13H,11H2,1H3,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 220.9°C |
| Boiling Point: | 441.6°Cat760mmHg |
| Density: | 1.403g/cm3 |
| Refractive index: | 1.629 |
| Specification: | usageEng:Antihypertensive agent Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 220.9°C |
| Storage Temperature: | −20°C |
| Usage: |
3-Hydroxy-alpha-methyltyrosine (CAS NO.55-40-3) is used in organic synthesis. |
| Safety Data | |
 |
|
