| Identification | |
| Name: | D-Tyrosine, 3-hydroxy- |
| CAS: | 5796-17-8 |
| EINECS: | 227-343-0 |
| Molecular Formula: | C9H11NO4 |
| Molecular Weight: | 197.18794 |
| InChI: | InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.468 g/cm3 |
| Refractive index: | 1.654 |
| Water Solubility: | 0.5 M HCl: soluble |
| Solubility: | 0.5 M HCl: soluble |
| Appearance: | white to tan powder |
| Specification: | Tan Solid usageEng:A DOPA enantiomer that lacks biological activity. |
| Storage Temperature: | −20°C |
| Color: | white to tan |
| Usage: | A DOPA enantiomer that lacks biological activity. |
| Safety Data | |
 |
|
