| Identification | |
| Name: | Butethamine hydrochloride |
| Synonyms: | 2-(2-methylpropylamino)ethyl 4-aminobenzoate hydrochloride;2-(2-methylpropylamino)ethyl 4-azanylbenzoate hydrochloride;4-aminobenzoic acid 2-(isobutylamino)ethyl ester hydrochloride |
| CAS: | 553-68-4 |
| Molecular Formula: | C13H20N2O2 . ClH |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C13H20N2O2.ClH/c1-10(2)9-15-7-8-17-13(16)11-3-5-12(14)6-4-11;/h3-6,10,15H,7-9,14H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.9°C |
| Boiling Point: | 383.7°Cat760mmHg |
| Density: | 1.067g/cm3 |
| Specification: |
Butethamine hydrochloride , its cas register number is 553-68-4. It also can be called 2-(Isobutylamino)ethyl p-aminobenzoate hydrochloride ; 2-Isobutylaminoethanol hydrochloric acid salt, p-aminobenzoic acid ester ; Benzoic acid, p-amino-, 2-(isobutylamino)ethyl ester, hydrochloride ; Butethamine HCl ; Ibylcaine hydrochloride ; Monocaine hydrochloride ; NSC 10821 ; UNII-0M63DKI91K ; p-Aminobenzoic acid 2-(isobutylamino)ethyl ester hydrochloride ; p-Aminobenzoic acid ester of 2-isobutylaminoethanol ; hydrochloric acid salt ; Ethanol, 2-((2-methylpropyl)amino)-, 4-aminobenzoate |
| Flash Point: | 185.9°C |
| Safety Data | |
 |
|
