Identification |
Name: | N-Benzoyloxy-N-ethyl-4-aminoazobenzene |
Synonyms: | N-Benzoyloxy-N-ethyl-4-aminoazobenzene;BENZOIC ACID, ester with N-ETHYL-N-(p-(PHENYLAZO)PHENYL)HYDROXYLAMINE;AC1L25QS;LS-37424;(N-ethyl-4-phenyldiazenylanilino) benzoate;55398-24-8 |
CAS: | 55398-24-8 |
Molecular Formula: | C21H19N3O2 |
Molecular Weight: | 345.3945 |
InChI: | InChI=1/C21H19N3O2/c1-2-24(26-21(25)17-9-5-3-6-10-17)20-15-13-19(14-16-20)23-22-18-11-7-4-8-12-18/h3-16H,2H2,1H3/b23-22+ |
Molecular Structure: |
|
Properties |
Flash Point: | 254.8°C |
Boiling Point: | 497.7°C at 760 mmHg |
Density: | 1.12g/cm3 |
Refractive index: | 1.588 |
Specification: |
N-Benzoyloxy-N-ethyl-4-aminoazobenzene (CAS NO.55398-24-8) is also named as Benzoic acid, ester with N-ethyl-N-(p-(phenylazo)phenyl)hydroxylamine .
|
Flash Point: | 254.8°C |
Safety Data |
|
|