| Identification | |
| Name: | N-Hydroxy-N-ethyl-4-aminoazobenzene |
| Synonyms: | N-Hydroxy-eab;N-Hydroxy-N-ethyl-4-aminoazobenzene;N-Hydroxy-N-ethyl-p-(phenylazo) aniline;N-Ethyl-N-hydroxy-4-(phenylazo)benzenamine;N-Ethyl-N-(p-(phenylazo)phenyl)hydroxylamine;Hydroxylamine, N-ethyl-N-(p-(phenylazo)phenyl)-;58989-02-9;AC1L558B;LS-77423;N-ethyl-N-(4-phenyldiazenylphenyl)hydroxylamine;N-ethyl-N-hydroxy-4-[(E)-phenyldiazenyl]aniline |
| CAS: | 58989-02-9 |
| Molecular Formula: | C14H15N3O |
| Molecular Weight: | 241.2884 |
| InChI: | InChI=1/C14H15N3O/c1-2-17(18)14-10-8-13(9-11-14)16-15-12-6-4-3-5-7-12/h3-11,18H,2H2,1H3/b16-15+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 202.2°C |
| Boiling Point: | 410.7°C at 760 mmHg |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.582 |
| Specification: |
N-Hydroxy-N-ethyl-4-aminoazobenzene , its cas register number is 58989-02-9. It also can be called N-Hydroxy-eab ; Hydroxylamine, N-ethyl-N-(p-(phenylazo)phenyl)- ; N-Hydroxy-N-ethyl-p-(phenylazo) aniline ; and N-Ethyl-N-(p-(phenylazo)phenyl)hydroxylamine . |
| Flash Point: | 202.2°C |
| Safety Data | |
 |
|
