| Identification |
| Name: | 4-Nitrophenylacetonitrile |
| Synonyms: | 4-Nitrobenzyl cyanide; p-Nitrobenzyl cyanide; p-nitrophenylacetonitrile; Benzeneacetonitrile, 4-nitro-; |
| CAS: | 555-21-5 |
| EINECS: | 209-085-0 |
| Molecular Formula: | C8H6N2O2 |
| Molecular Weight: | 162.15 |
| InChI: | InChI=1/C8H6N2O2/c9-6-5-7-1-3-8(4-2-7)10(11)12/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3439 |
| Density: | 1.272 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.577 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | cream to yellow crystalline powder |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Substance is used in the prepn of p-nitrophenylacetic acid. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
