| Identification | |
| Name: | DICYANOFURAZAN-N-OXIDE |
| Synonyms: | 1,2,5-Oxadiazole-3,4-dicarbonitrile |
| CAS: | 55644-07-0 |
| Molecular Formula: | C4N4O |
| Molecular Weight: | 120.069 |
| InChI: | InChI=1/C4N4O/c5-1-3-4(2-6)8-9-7-3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 180.7°C |
| Boiling Point: | 375.2°C at 760 mmHg |
| Density: | 1.54g/cm3 |
| Refractive index: | 1.527 |
| Specification: |
Dicyanofurazan-n-oxide ,its CAS NO. is 55644-07-0,the synonyms is 3,4-Dicyano-1,2,4-oxadiazole . |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 180.7°C |
| Safety Data | |
 |
|
